Difference between revisions of "CPD-15654"

Revision as of 14:56, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12929 ==
+== Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE ==
 * common-name:
-** 5&alpha;-cholesta-7,24-dien-3-one
+** 1d-myo-inositol 1-monophosphate
+* smiles:
+** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
 * inchi-key:
-** lhhhzzhkuvlcji-iinkennysa-n
+** inapmgsxuvuwaf-uotptpdrsa-l
 * molecular-weight:
-** 382.628
+** 258.121
-* smiles:
-** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(ccc(=o)c[c@h](cc=1)2)(c))cc[c@](c)34)))
 == Reaction(s) known to consume the compound ==
-* [[RXN-21837]]
+* [[RXN-16261]]
+* [[RXN0-5408]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-16261]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5&alpha;-cholesta-7,24-dien-3-one}}
+{{#set: common-name=1d-myo-inositol 1-monophosphate}}
-{{#set: inchi-key=inchikey=lhhhzzhkuvlcji-iinkennysa-n}}
+{{#set: inchi-key=inchikey=inapmgsxuvuwaf-uotptpdrsa-l}}
-{{#set: molecular-weight=382.628}}
+{{#set: molecular-weight=258.121}}