Difference between revisions of "CPD-15655"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00644 == * transcription-direction: ** positive * right-end-position: ** 68682 * left-end-position: ** 57734 * centisome-position: ** 35.113735...")
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00644 ==
+
== Metabolite MALTOPENTAOSE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** maltopentaose
−
* right-end-position:
+
* smiles:
−
** 68682
+
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
−
* left-end-position:
+
* inchi-key:
−
** 57734
+
** ftnipwxxignqqf-hzwihctqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 35.113735   
+
** 828.725
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14281]]
−
== Reaction(s) associated ==
+
* [[RXN-14284]]
−
* [[NITRATE-REDUCTASE-NADH-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-14282]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14285]]
−
* [[NITRATE-REDUCTASE-NADPH-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=maltopentaose}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
−
* [[NITRATREDUCT-RXN]]
+
{{#set: molecular-weight=828.725}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-381]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5675]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=68682}}
 
−
{{#set: left-end-position=57734}}
 
−
{{#set: centisome-position=35.113735    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • molecular-weight:
    • 828.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15655&oldid=46845"