Difference between revisions of "CPD-15656"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08442 == * transcription-direction: ** positive * right-end-position: ** 43927 * left-end-position: ** 39283 * centisome-position: ** 74.00158...") |
(Created page with "Category:metabolite == Metabolite CPD-15656 == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15656 == |
| − | * | + | * common-name: |
| − | ** | + | ** (3e)-undec-2-enoyl-coa |
| − | + | * smiles: | |
| − | + | ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | * | + | ** cavmkinpgrcurl-phhhidlgsa-j |
| − | + | * molecular-weight: | |
| − | ** | + | ** 929.765 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-14778]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(3e)-undec-2-enoyl-coa}} | |
| − | * | + | {{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}} |
| − | ** | + | {{#set: molecular-weight=929.765}} |
| − | * | ||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-15656
- common-name:
- (3e)-undec-2-enoyl-coa
- smiles:
- ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cavmkinpgrcurl-phhhidlgsa-j
- molecular-weight:
- 929.765
