Difference between revisions of "CPD-15656"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Myristoyl-ACPs == * common-name: ** a myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10727 * RXN-17017 * [...")
(Created page with "Category:metabolite == Metabolite CPD-15656 == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Myristoyl-ACPs ==
+
== Metabolite CPD-15656 ==
 
* common-name:
 
* common-name:
** a myristoyl-[acp]
+
** (3e)-undec-2-enoyl-coa
 +
* smiles:
 +
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** cavmkinpgrcurl-phhhidlgsa-j
 +
* molecular-weight:
 +
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10727]]
+
* [[RXN-14778]]
* [[RXN-17017]]
 
* [[RXN-17022]]
 
* [[RXN-17024]]
 
* [[RXN-9539]]
 
* [[RXN-9654]]
 
* [[RXN3O-8214]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9538]]
 
* [[RXN-9662]]
 
* [[RXN3O-8214]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a myristoyl-[acp]}}
+
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
 +
{{#set: molecular-weight=929.765}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-15656

  • common-name:
    • (3e)-undec-2-enoyl-coa
  • smiles:
    • ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cavmkinpgrcurl-phhhidlgsa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality