Difference between revisions of "CPD-15657"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19532 == * transcription-direction: ** negative * right-end-position: ** 74310 * left-end-position: ** 68801 * centisome-position: ** 30.500546...")
(Created page with "Category:metabolite == Metabolite CPD-15657 == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19532 ==
+
== Metabolite CPD-15657 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (3r)-hydroxy-undecanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 74310
+
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 68801
+
** jiogxinzsoqege-mawalykisa-j
−
* centisome-position:
+
* molecular-weight:
−
** 30.500546   
+
** 947.78
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-14778]]
−
* [[1.5.1.20-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
−
* [[UROGENIIISYN-RXN]]
+
{{#set: molecular-weight=947.78}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[1CMET2-PWY]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-3841]]
 
−
** '''9''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-2201]]
 
−
** '''9''' reactions found over '''12''' reactions in the full pathway
 
−
* [[CODH-PWY]]
 
−
** '''4''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5189]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5188]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=74310}}
 
−
{{#set: left-end-position=68801}}
 
−
{{#set: centisome-position=30.500546    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15657

  • common-name:
    • (3r)-hydroxy-undecanoyl-coa
  • smiles:
    • ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jiogxinzsoqege-mawalykisa-j
  • molecular-weight:
    • 947.78

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15657&oldid=137568"