Difference between revisions of "CPD-15657"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21564 == * transcription-direction: ** positive * right-end-position: ** 372873 * left-end-position: ** 368358 * centisome-position: ** 61.890495...")
 
(Created page with "Category:metabolite == Metabolite CPD-15657 == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21564 ==
+
== Metabolite CPD-15657 ==
* transcription-direction:
+
* common-name:
** positive
+
** (3r)-hydroxy-undecanoyl-coa
* right-end-position:
+
* smiles:
** 372873
+
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 368358
+
** jiogxinzsoqege-mawalykisa-j
* centisome-position:
+
* molecular-weight:
** 61.890495   
+
** 947.78
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-14778]]
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=947.78}}
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[LEU-DEG2-PWY]]
 
** '''4''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY66-367]]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-5074]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=372873}}
 
{{#set: left-end-position=368358}}
 
{{#set: centisome-position=61.890495    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15657

  • common-name:
    • (3r)-hydroxy-undecanoyl-coa
  • smiles:
    • ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jiogxinzsoqege-mawalykisa-j
  • molecular-weight:
    • 947.78

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality