Difference between revisions of "CPD-15657"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...")
(Created page with "Category:metabolite == Metabolite CPD-8564 == * smiles: ** c(=o)([a protein])c(n[a protein])co * common-name: ** a [myosin light-chain] l-serine == Reaction(s) known to co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-558 ==
+
== Metabolite CPD-8564 ==
 +
* smiles:
 +
** c(=o)([a protein])c(n[a protein])co
 
* common-name:
 
* common-name:
** pimeloyl-coa
+
** a [myosin light-chain] l-serine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** lycrxmtyuzduga-uyrkptjqsa-i
 
* molecular-weight:
 
** 904.649
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7KAPSYN-RXN]]
+
* [[2.7.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.11.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimeloyl-coa}}
+
{{#set: common-name=a [myosin light-chain] l-serine}}
{{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}}
 
{{#set: molecular-weight=904.649}}
 

Revision as of 13:09, 14 January 2021

Metabolite CPD-8564

  • smiles:
    • c(=o)([a protein])c(n[a protein])co
  • common-name:
    • a [myosin light-chain] l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [myosin light-chain] l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.