Difference between revisions of "CPD-15658"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18 == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
(Created page with "Category:metabolite == Metabolite Trans-D2-hexacos-2-enoyl-ACPs == * common-name: ** a trans-hexacos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18 ==
+
== Metabolite Trans-D2-hexacos-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** linoleoyl-coa
+
** a trans-hexacos-2-enoyl-[acp]
* smiles:
 
** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** yecllimzhnyfck-rrnjgntnsa-j
 
* molecular-weight:
 
** 1025.937
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.19.3-RXN]]
+
* [[RXN-10062]]
* [[FACOAE182]]
 
* [[LINOLEOYL-RXN]]
 
* [[RXN-16094]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LNLCCOAL]]
+
* [[RXN-10061]]
* [[RXN-16045]]
 
* [[RXN-9601]]
 
* [[RXN-9673]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=linoleoyl-coa}}
+
{{#set: common-name=a trans-hexacos-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}}
 
{{#set: molecular-weight=1025.937}}
 

Revision as of 13:12, 14 January 2021

Metabolite Trans-D2-hexacos-2-enoyl-ACPs

  • common-name:
    • a trans-hexacos-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-hexacos-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.