Difference between revisions of "CPD-15661"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oleoyl-ACPs == * common-name: ** an oleoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16077 * RXN-16629 == React...") |
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15661 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-trans, 4-trans-undecadienoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** szkpluulggerfd-msnzeopqsa-j | ||
| + | * molecular-weight: | ||
| + | ** 927.749 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14790]] |
| − | * [[RXN- | + | * [[RXN-14791]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14789]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}} |
| + | {{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}} | ||
| + | {{#set: molecular-weight=927.749}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-15661
- common-name:
- 2-trans, 4-trans-undecadienoyl-coa
- smiles:
- ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- szkpluulggerfd-msnzeopqsa-j
- molecular-weight:
- 927.749
