Difference between revisions of "CPD-15661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-2-N-linked-Glycan == * common-name: ** man3glcnac4-[protein] == Reaction(s) known to consume the compound == * 2.4.1.145-RXN * 2....")
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-2-N-linked-Glycan ==
+
== Metabolite CPD-15661 ==
 
* common-name:
 
* common-name:
** man3glcnac4-[protein]
+
** 2-trans, 4-trans-undecadienoyl-coa
 +
* smiles:
 +
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** szkpluulggerfd-msnzeopqsa-j
 +
* molecular-weight:
 +
** 927.749
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.145-RXN]]
+
* [[RXN-14790]]
* [[2.4.1.68-RXN]]
+
* [[RXN-14791]]
* [[2.4.2.38-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=man3glcnac4-[protein]}}
+
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
 +
{{#set: molecular-weight=927.749}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15661

  • common-name:
    • 2-trans, 4-trans-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-msnzeopqsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality