Difference between revisions of "CPD-15661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6501 RXN-6501] == * direction: ** left-to-right * common-name: ** d-inositol-3-phosphate glycos...")
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6501 RXN-6501] ==
+
== Metabolite CPD-15661 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** d-inositol-3-phosphate glycosyltransferase
+
** 2-trans, 4-trans-undecadienoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.250 ec-2.4.1.250]
+
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[1-L-MYO-INOSITOL-1-P]][c] '''+''' 1 [[UDP-N-ACETYL-D-GLUCOSAMINE]][c] '''=>''' 1 [[CPD-11975]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
** szkpluulggerfd-msnzeopqsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17094]]
+
** 927.749
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14790]]
−
== Pathway(s) ==
+
* [[RXN-14791]]
−
* [[PWY1G-0]], mycothiol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-14789]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
−
* RHEA:
+
{{#set: molecular-weight=927.749}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26189 26189]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=d-inositol-3-phosphate glycosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.1.250}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15661

  • common-name:
    • 2-trans, 4-trans-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-msnzeopqsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15661&oldid=139497"