Difference between revisions of "CPD-15661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERINE-O-ACETYLTRANSFERASE-RXN HOMOSERINE-O-ACETYLTRANSFERASE-RXN] == * direction: ** reversibl...")
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERINE-O-ACETYLTRANSFERASE-RXN HOMOSERINE-O-ACETYLTRANSFERASE-RXN] ==
+
== Metabolite CPD-15661 ==
* direction:
+
* common-name:
** reversible
+
** 2-trans, 4-trans-undecadienoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1.31 ec-2.3.1.31]
+
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ACETYL-COA]][c] '''+''' 1 [[HOMO-SER]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-667]][c]
+
** szkpluulggerfd-msnzeopqsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
== Pathway(s) ==
+
** 927.749
* [[PWY-5344]], L-homocysteine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5344 PWY-5344]
+
== Reaction(s) known to consume the compound ==
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-14790]]
== Reconstruction information  ==
+
* [[RXN-14791]]
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[RXN-14789]]
* RHEA:
+
== Reaction(s) of unknown directionality ==
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13704 13704]
+
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
** [http://www.genome.jp/dbget-bin/www_bget?R01776 R01776]
+
{{#set: molecular-weight=927.749}}
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P08465 P08465]
 
** [http://www.uniprot.org/uniprot/O60062 O60062]
 
** [http://www.uniprot.org/uniprot/P94891 P94891]
 
** [http://www.uniprot.org/uniprot/P12917 P12917]
 
{{#set: direction=reversible}}
 
{{#set: ec-number=ec-2.3.1.31}}
 
{{#set: nb gene associated=0}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=gap-filling}}
 
{{#set: reconstruction tool=meneco}}
 
{{#set: reconstruction comment=added for gapfilling}}
 
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15661

  • common-name:
    • 2-trans, 4-trans-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-msnzeopqsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality