|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ15262 == | + | == Metabolite CPD-15662 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** (3r)-hydroxy, 4-trans-undecenoyl-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 75306
| + | ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 60939 | + | ** anvriwfxmmcuph-qyzxfxbmsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 20.379711 | + | ** 945.764 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated == | + | * [[RXN-14791]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[ACYLCOADEHYDROG-RXN]]
| + | {{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=945.764}} |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[PPCOAOm]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-11734]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13615]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-14229]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-14262]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14264]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14278]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-17775]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17779]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17783]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17784]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17788]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17792]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17796]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[FAO-PWY]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7094]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=75306}}
| |
| − | {{#set: left-end-position=60939}}
| |
| − | {{#set: centisome-position=20.379711 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
| − | {{#set: nb reaction associated=16}}
| |
| − | {{#set: nb pathway associated=2}}
| |
