Difference between revisions of "CPD-15662"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15262 == * transcription-direction: ** positive * right-end-position: ** 75306 * left-end-position: ** 60939 * centisome-position: ** 20.379711...") |
(Created page with "Category:metabolite == Metabolite CPD-15662 == * common-name: ** (3r)-hydroxy, 4-trans-undecenoyl-coa * smiles: ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15662 == |
− | * | + | * common-name: |
− | ** | + | ** (3r)-hydroxy, 4-trans-undecenoyl-coa |
− | + | * smiles: | |
− | + | ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | * | + | ** anvriwfxmmcuph-qyzxfxbmsa-j |
− | + | * molecular-weight: | |
− | ** | + | ** 945.764 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | = | + | * [[RXN-14791]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}} | |
− | + | {{#set: molecular-weight=945.764}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15662
- common-name:
- (3r)-hydroxy, 4-trans-undecenoyl-coa
- smiles:
- ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- anvriwfxmmcuph-qyzxfxbmsa-j
- molecular-weight:
- 945.764