Difference between revisions of "CPD-15662"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD-15662 == * common-name: ** (3r)-hydroxy, 4-trans-undecenoyl-coa * smiles: ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Poly-beta-D-Mannuronate ==
+
== Metabolite CPD-15662 ==
 
* common-name:
 
* common-name:
** mannuronan
+
** (3r)-hydroxy, 4-trans-undecenoyl-coa
 +
* smiles:
 +
** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** anvriwfxmmcuph-qyzxfxbmsa-j
 +
* molecular-weight:
 +
** 945.764
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9839]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALGINATE-SYNTHASE-RXN]]
+
* [[RXN-14791]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mannuronan}}
+
{{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}}
 +
{{#set: molecular-weight=945.764}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15662

  • common-name:
    • (3r)-hydroxy, 4-trans-undecenoyl-coa
  • smiles:
    • ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • anvriwfxmmcuph-qyzxfxbmsa-j
  • molecular-weight:
    • 945.764

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality