Difference between revisions of "CPD-15662"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPDMETA-13651 == * common-name: ** perakine * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6))))) * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDMETA-13651 == |
* common-name: | * common-name: | ||
| − | ** | + | ** perakine |
| + | * smiles: | ||
| + | ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6))))) | ||
| + | * inchi-key: | ||
| + | ** gdxjmogwonjrhl-vqhwpedhsa-n | ||
| + | * molecular-weight: | ||
| + | ** 350.416 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12673]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=perakine}} |
| + | {{#set: inchi-key=inchikey=gdxjmogwonjrhl-vqhwpedhsa-n}} | ||
| + | {{#set: molecular-weight=350.416}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPDMETA-13651
- common-name:
- perakine
- smiles:
- cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
- inchi-key:
- gdxjmogwonjrhl-vqhwpedhsa-n
- molecular-weight:
- 350.416
