Difference between revisions of "CPD-15663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD0-1108 == * common-name: ** β-d-ribofuranose * smiles: ** c(c1(c(o)c(o)c(o)o1))o * inchi-key: ** hmfhbzshggewlo-txicztdvsa-n * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-AMP ==
+
== Metabolite CPD0-1108 ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-amp
+
** β-d-ribofuranose
 
* smiles:
 
* smiles:
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+
** c(c1(c(o)c(o)c(o)o1))o
 
* inchi-key:
 
* inchi-key:
** rtqmrtsptliihm-keohhstqsa-j
+
** hmfhbzshggewlo-txicztdvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 555.288
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTCYCLOHYD-RXN]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTPRATPHYD-RXN]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-amp}}
+
{{#set: common-name=β-d-ribofuranose}}
{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
+
{{#set: inchi-key=inchikey=hmfhbzshggewlo-txicztdvsa-n}}
{{#set: molecular-weight=555.288}}
+
{{#set: molecular-weight=150.131}}

Revision as of 11:18, 15 January 2021

Metabolite CPD0-1108

  • common-name:
    • β-d-ribofuranose
  • smiles:
    • c(c1(c(o)c(o)c(o)o1))o
  • inchi-key:
    • hmfhbzshggewlo-txicztdvsa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality