Difference between revisions of "CPD-15663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1108 == * common-name: ** β-d-ribofuranose * smiles: ** c(c1(c(o)c(o)c(o)o1))o * inchi-key: ** hmfhbzshggewlo-txicztdvsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-15663 == * common-name: ** 2-trans-nonenoyl-coa * smiles: ** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15663 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-trans-nonenoyl-coa |
* smiles: | * smiles: | ||
| − | ** c( | + | ** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hblotzdypzazle-owqwvslfsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 901.711 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14794]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14793]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-trans-nonenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hblotzdypzazle-owqwvslfsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=901.711}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15663
- common-name:
- 2-trans-nonenoyl-coa
- smiles:
- ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hblotzdypzazle-owqwvslfsa-j
- molecular-weight:
- 901.711
