Difference between revisions of "CPD-15663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13404 RXN-13404] == * direction: ** left-to-right * common-name: ** sarcosine n-methyltransfera...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13404 RXN-13404] ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** sarcosine n-methyltransferase
+
** phosphoribulosylformimino-aicar-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.156 ec-2.1.1.156]
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
== Reaction formula ==
+
* inchi-key:
* 1 [[GLY]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 2 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DIMETHYL-GLYCINE]][c] '''+''' 2 [[PROTON]][c]
+
** blkfnhochnclii-ghvqhmavsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 573.303
* Gene: [[SJ12128]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[GLUTAMIDOTRANS-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17900]]
* Gene: [[SJ18177]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[PRIBFAICARPISOM-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PRICI]]
* Gene: [[SJ14716]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
* Gene: [[SJ12119]]
+
{{#set: molecular-weight=573.303}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ03081]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11087]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ02539]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ10116]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ02540]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ12116]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ12118]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R10060 R10060]
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32466 32466]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=sarcosine n-methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.156}}
 
{{#set: nb gene associated=11}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality