Difference between revisions of "CPD-15663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...")
(Created page with "Category:metabolite == Metabolite CPD-14795 == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-380 ==
+
== Metabolite CPD-14795 ==
 
* common-name:
 
* common-name:
** 3-sulfopyruvate
+
** udp-n-acetyl-α-d-galactosamine
 
* smiles:
 
* smiles:
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
+
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
 
* inchi-key:
 
* inchi-key:
** buthmsuebypmkj-uhfffaoysa-l
+
** lftytuazoprmmi-nessujcysa-l
 
* molecular-weight:
 
* molecular-weight:
** 166.105
+
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R230-RXN]]
+
* [[RXN-13760]]
* [[RXN-11737]]
+
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R230-RXN]]
+
* [[RXN-13760]]
* [[RXN-11737]]
+
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfopyruvate}}
+
{{#set: common-name=udp-n-acetyl-α-d-galactosamine}}
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
{{#set: molecular-weight=166.105}}
+
{{#set: molecular-weight=605.342}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-14795

  • common-name:
    • udp-n-acetyl-α-d-galactosamine
  • smiles:
    • cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
  • inchi-key:
    • lftytuazoprmmi-nessujcysa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality