Difference between revisions of "CPD-15667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite CPD-676 ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** trans-caffeate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** qaiprvgongvqas-duxpyhpusa-m
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 179.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11396]]
+
* [[RXN-1104]]
* [[RXN-14205]]
+
* [[RXN-1126]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14205]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=trans-caffeate}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=179.152}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-676

  • common-name:
    • trans-caffeate
  • smiles:
    • c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
  • inchi-key:
    • qaiprvgongvqas-duxpyhpusa-m
  • molecular-weight:
    • 179.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality