Difference between revisions of "CPD-15667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...")
(Created page with "Category:metabolite == Metabolite CPD-17278 == * common-name: ** a [glycerolipid]-stearidonate == Reaction(s) known to consume the compound == * RXN-11682 * RXN-1604...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-676 ==
+
== Metabolite CPD-17278 ==
 
* common-name:
 
* common-name:
** trans-caffeate
+
** a [glycerolipid]-stearidonate
* smiles:
 
** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
 
* inchi-key:
 
** qaiprvgongvqas-duxpyhpusa-m
 
* molecular-weight:
 
** 179.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1104]]
+
* [[RXN-11682]]
* [[RXN-1126]]
+
* [[RXN-16041]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16040]]
 +
* [[RXN-8347]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-caffeate}}
+
{{#set: common-name=a [glycerolipid]-stearidonate}}
{{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}}
 
{{#set: molecular-weight=179.152}}
 

Revision as of 11:19, 15 January 2021

Metabolite CPD-17278

  • common-name:
    • a [glycerolipid]-stearidonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-stearidonate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.