Difference between revisions of "CPD-15667"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13935 RXN-13935] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-15667 == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15667 == |
− | * | + | * common-name: |
− | ** | + | ** 6-cis, 3-oxo-tridecenoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | == | + | * inchi-key: |
− | + | ** fdxhxlpclxeysu-dxazuofzsa-j | |
− | = | + | * molecular-weight: |
− | + | ** 971.802 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-14774]] |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}} |
− | + | {{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}} | |
− | + | {{#set: molecular-weight=971.802}} | |
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | == | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-15667
- common-name:
- 6-cis, 3-oxo-tridecenoyl-coa
- smiles:
- ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fdxhxlpclxeysu-dxazuofzsa-j
- molecular-weight:
- 971.802