Difference between revisions of "CPD-15667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
(Created page with "Category:metabolite == Metabolite CPD-15667 == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite CPD-15667 ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** 6-cis, 3-oxo-tridecenoyl-coa
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** fdxhxlpclxeysu-dxazuofzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 971.802
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11396]]
+
* [[RXN-14774]]
* [[RXN-14205]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14205]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=971.802}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15667

  • common-name:
    • 6-cis, 3-oxo-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fdxhxlpclxeysu-dxazuofzsa-j
  • molecular-weight:
    • 971.802

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality