Difference between revisions of "CPD-15667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-terminal-unsaturated-sugars == * common-name: ** a 3'-terminal unsaturated sugar == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-terminal-unsaturated-sugars ==
+
== Metabolite CPD0-1905 ==
 
* common-name:
 
* common-name:
** a 3'-terminal unsaturated sugar
+
** 8-oxo-dgtp
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** buzogvvqwcxxdp-vpeninkcsa-j
 +
* molecular-weight:
 +
** 519.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11396]]
 +
* [[RXN-14205]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.99.18-RXN]]
+
* [[RXN-14205]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3'-terminal unsaturated sugar}}
+
{{#set: common-name=8-oxo-dgtp}}
 +
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
 +
{{#set: molecular-weight=519.151}}

Revision as of 13:13, 14 January 2021

Metabolite CPD0-1905

  • common-name:
    • 8-oxo-dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • buzogvvqwcxxdp-vpeninkcsa-j
  • molecular-weight:
    • 519.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality