Difference between revisions of "CPD-15668"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8462 == * common-name: ** pentadecanoate * smiles: ** ccccccccccccccc([o-])=o * inchi-key: ** wqepluugtldzjy-uhfffaoysa-m * molecular...")
(Created page with "Category:metabolite == Metabolite CPD-15668 == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8462 ==
+
== Metabolite CPD-15668 ==
 
* common-name:
 
* common-name:
** pentadecanoate
+
** 4-cis-undecenoyl-coa
 
* smiles:
 
* smiles:
** ccccccccccccccc([o-])=o
+
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** wqepluugtldzjy-uhfffaoysa-m
+
** afmmiiqkxqnedn-nsdzghcesa-j
 
* molecular-weight:
 
* molecular-weight:
** 241.393
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14775]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]]
+
* [[RXN-14774]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pentadecanoate}}
+
{{#set: common-name=4-cis-undecenoyl-coa}}
{{#set: inchi-key=inchikey=wqepluugtldzjy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}}
{{#set: molecular-weight=241.393}}
+
{{#set: molecular-weight=929.765}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15668

  • common-name:
    • 4-cis-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-nsdzghcesa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality