Difference between revisions of "CPD-15668"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17757 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate * smiles: ** cc(=o)nc2(c(o)oc(c...") |
(Created page with "Category:metabolite == Metabolite CPD-15668 == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15668 == |
* common-name: | * common-name: | ||
| − | ** 4- | + | ** 4-cis-undecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** afmmiiqkxqnedn-nsdzghcesa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 929.765 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14775]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14774]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=4- | + | {{#set: common-name=4-cis-undecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=929.765}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15668
- common-name:
- 4-cis-undecenoyl-coa
- smiles:
- ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- afmmiiqkxqnedn-nsdzghcesa-j
- molecular-weight:
- 929.765
