Difference between revisions of "CPD-15675"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Non-Glucur-Glucuronoside-Acceptors == * common-name: ** a non-glucuronated glucosyluronate acceptor == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Non-Glucur-Glucuronoside-Acceptors ==
+
== Metabolite CPD-15675 ==
 
* common-name:
 
* common-name:
** a non-glucuronated glucosyluronate acceptor
+
** 2-trans-6-trans-tridecadienoyl-coa
 +
* smiles:
 +
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** oosdlbaxvxkfib-bjbrngjvsa-j
 +
* molecular-weight:
 +
** 955.803
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
* [[RXN-14786]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14785]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a non-glucuronated glucosyluronate acceptor}}
+
{{#set: common-name=2-trans-6-trans-tridecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-bjbrngjvsa-j}}
 +
{{#set: molecular-weight=955.803}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15675

  • common-name:
    • 2-trans-6-trans-tridecadienoyl-coa
  • smiles:
    • ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oosdlbaxvxkfib-bjbrngjvsa-j
  • molecular-weight:
    • 955.803

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality