Difference between revisions of "CPD-15676"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17017 == * transcription-direction: ** negative * right-end-position: ** 170322 * left-end-position: ** 148337 * centisome-position: ** 54.272087...")
 
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17017 ==
+
== Metabolite CPD-15676 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 6-trans-3-oxo-tridecenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 170322
+
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 148337
+
** fdxhxlpclxeysu-hmxwsvnbsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 54.272087   
+
** 971.802
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14788]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.223-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
−
* [[2.4.1.94-RXN]]
+
{{#set: molecular-weight=971.802}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[2.4.2.38-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-11889]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11890]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15205]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6558]]
 
−
** '''7''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-7920]]
 
−
** '''2''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-7437]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=170322}}
 
−
{{#set: left-end-position=148337}}
 
−
{{#set: centisome-position=54.272087    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-15676

  • common-name:
    • 6-trans-3-oxo-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fdxhxlpclxeysu-hmxwsvnbsa-j
  • molecular-weight:
    • 971.802

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15676&oldid=136662"