Difference between revisions of "CPD-15676"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE == * common-name: ** 1,2-dipalmitoyl-phosphatidylcholine * smiles: ** cccccccccccccccc(occ(oc(=o)ccccc...")
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE ==
+
== Metabolite CPD-15676 ==
 
* common-name:
 
* common-name:
** 1,2-dipalmitoyl-phosphatidylcholine
+
** 6-trans-3-oxo-tridecenoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccc(occ(oc(=o)ccccccccccccccc)cop(occ[n+](c)(c)c)([o-])=o)=o
+
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** kilnvbdswzsgll-kxqooqhdsa-n
+
** fdxhxlpclxeysu-hmxwsvnbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 734.048
+
** 971.802
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15065]]
+
* [[RXN-14788]]
* [[RXN-15066]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15066]]
 
* [[RXN66-578]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dipalmitoyl-phosphatidylcholine}}
+
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=kilnvbdswzsgll-kxqooqhdsa-n}}
+
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
{{#set: molecular-weight=734.048}}
+
{{#set: molecular-weight=971.802}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-15676

  • common-name:
    • 6-trans-3-oxo-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fdxhxlpclxeysu-hmxwsvnbsa-j
  • molecular-weight:
    • 971.802

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality