Difference between revisions of "CPD-15676"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...") |
(Created page with "Category:metabolite == Metabolite D-Gal-NAc--Glycoproteins == * common-name: ** an n-acetyl-α-d-galactosalaminyl-[glycoprotein] == Reaction(s) known to consume the c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-Gal-NAc--Glycoproteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acetyl-α-d-galactosalaminyl-[glycoprotein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.122-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-α-d-galactosalaminyl-[glycoprotein]}} |
| − | |||
| − | |||
Revision as of 13:07, 14 January 2021
Contents
Metabolite D-Gal-NAc--Glycoproteins
- common-name:
- an n-acetyl-α-d-galactosalaminyl-[glycoprotein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-α-d-galactosalaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
