Difference between revisions of "CPD-15677"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GST-RXN GST-RXN] == * direction: ** reversible * common-name: ** glutathione s-transferase ** gluta...") |
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15677 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 4-trans-undecenoyl-coa |
− | + | * smiles: | |
− | * | + | ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | ** | + | * inchi-key: |
− | == | + | ** afmmiiqkxqnedn-dupkwvsksa-j |
− | + | * molecular-weight: | |
− | = | + | ** 929.765 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-14789]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14788]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-trans-undecenoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}} | |
− | + | {{#set: molecular-weight=929.765}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15677
- common-name:
- 4-trans-undecenoyl-coa
- smiles:
- ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- afmmiiqkxqnedn-dupkwvsksa-j
- molecular-weight:
- 929.765