Difference between revisions of "CPD-15684"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DTDP-D-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dtdp-α-d-glucose |
| + | * smiles: | ||
| + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3)) | ||
| + | * inchi-key: | ||
| + | ** ysykrgrsmltjnl-urarbognsa-l | ||
| + | * molecular-weight: | ||
| + | ** 562.317 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dtdp-α-d-glucose}} |
| + | {{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}} | ||
| + | {{#set: molecular-weight=562.317}} | ||
Revision as of 11:18, 15 January 2021
Contents
Metabolite DTDP-D-GLUCOSE
- common-name:
- dtdp-α-d-glucose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
- inchi-key:
- ysykrgrsmltjnl-urarbognsa-l
- molecular-weight:
- 562.317
