Difference between revisions of "CPD-15684"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-15684 == * common-name: ** 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs ==
+
== Metabolite CPD-15684 ==
 
* common-name:
 
* common-name:
** a 3-oxo-cis-δ9-hexadecenoyl-[acp]
+
** 5-cis, 7-trans-tetradecadienoyl-coa
 +
* smiles:
 +
** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** amanzgdvbadzlh-qtjplklfsa-j
 +
* molecular-weight:
 +
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10659]]
+
* [[RXN-14796]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10658]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-cis-δ9-hexadecenoyl-[acp]}}
+
{{#set: common-name=5-cis, 7-trans-tetradecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=amanzgdvbadzlh-qtjplklfsa-j}}
 +
{{#set: molecular-weight=969.83}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15684

  • common-name:
    • 5-cis, 7-trans-tetradecadienoyl-coa
  • smiles:
    • ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • amanzgdvbadzlh-qtjplklfsa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality