Difference between revisions of "CPD-15684"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co...") |
(Created page with "Category:metabolite == Metabolite CPD-15684 == * common-name: ** 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15684 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-cis, 7-trans-tetradecadienoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** amanzgdvbadzlh-qtjplklfsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 969.83 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14796]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-cis, 7-trans-tetradecadienoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=amanzgdvbadzlh-qtjplklfsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=969.83}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15684
- common-name:
- 5-cis, 7-trans-tetradecadienoyl-coa
- smiles:
- ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- amanzgdvbadzlh-qtjplklfsa-j
- molecular-weight:
- 969.83
