Difference between revisions of "CPD-15684"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6981 RXN0-6981] == * direction: ** left-to-right * common-name: ** cytosolic dipeptidase * ec-...") |
(Created page with "Category:metabolite == Metabolite CPD-15684 == * common-name: ** 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15684 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 5-cis, 7-trans-tetradecadienoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == | + | * inchi-key: |
| − | + | ** amanzgdvbadzlh-qtjplklfsa-j | |
| − | = | + | * molecular-weight: |
| − | + | ** 969.83 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | *** | + | * [[RXN-14796]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=5-cis, 7-trans-tetradecadienoyl-coa}} | |
| − | == | + | {{#set: inchi-key=inchikey=amanzgdvbadzlh-qtjplklfsa-j}} |
| − | + | {{#set: molecular-weight=969.83}} | |
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15684
- common-name:
- 5-cis, 7-trans-tetradecadienoyl-coa
- smiles:
- ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- amanzgdvbadzlh-qtjplklfsa-j
- molecular-weight:
- 969.83
