Difference between revisions of "CPD-15685"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17402 == * common-name: ** (3r)-hydroxy-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
(Created page with "Category:metabolite == Metabolite CPD-15685 == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * smiles: ** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17402 ==
+
== Metabolite CPD-15685 ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-auricoloyl-coa
+
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** xtsclycoojhttr-ktfrusdtsa-j
+
** xpvhxtguzgacru-mcfmhthasa-j
 
* molecular-weight:
 
* molecular-weight:
** 1085.989
+
** 967.814
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16155]]
+
* [[RXN-14797]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16154]]
+
* [[RXN-14796]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-auricoloyl-coa}}
+
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
{{#set: inchi-key=inchikey=xtsclycoojhttr-ktfrusdtsa-j}}
+
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
{{#set: molecular-weight=1085.989}}
+
{{#set: molecular-weight=967.814}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-15685

  • common-name:
    • 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
  • smiles:
    • ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xpvhxtguzgacru-mcfmhthasa-j
  • molecular-weight:
    • 967.814

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality