Difference between revisions of "CPD-15686"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite ACRYLAMIDE == * common-name: ** acrylamide * smiles: ** c=cc(=o)n * inchi-key: ** hrpvxlwxlxdghg-uhfffaoysa-n * molecular-weight: ** 71.0...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1162 ==
+
== Metabolite ACRYLAMIDE ==
 
* common-name:
 
* common-name:
** (2e,5z)-tetradecenoyl-coa
+
** acrylamide
 
* smiles:
 
* smiles:
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c=cc(=o)n
 
* inchi-key:
 
* inchi-key:
** jvefyxpcqbmmaa-zmlwrgbosa-j
+
** hrpvxlwxlxdghg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 71.079
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5393]]
+
* [[R311-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14576]]
 
* [[RXN-17783]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
{{#set: common-name=acrylamide}}
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
+
{{#set: inchi-key=inchikey=hrpvxlwxlxdghg-uhfffaoysa-n}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=71.079}}

Revision as of 11:14, 15 January 2021

Metabolite ACRYLAMIDE

  • common-name:
    • acrylamide
  • smiles:
    • c=cc(=o)n
  • inchi-key:
    • hrpvxlwxlxdghg-uhfffaoysa-n
  • molecular-weight:
    • 71.079

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality