Difference between revisions of "CPD-15686"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACRYLAMIDE == * common-name: ** acrylamide * smiles: ** c=cc(=o)n * inchi-key: ** hrpvxlwxlxdghg-uhfffaoysa-n * molecular-weight: ** 71.0...")
(Created page with "Category:metabolite == Metabolite CPD-15686 == * common-name: ** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACRYLAMIDE ==
+
== Metabolite CPD-15686 ==
 
* common-name:
 
* common-name:
** acrylamide
+
** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
 
* smiles:
 
* smiles:
** c=cc(=o)n
+
** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hrpvxlwxlxdghg-uhfffaoysa-n
+
** zzvzpdqtnsjqpz-voxmgfccsa-j
 
* molecular-weight:
 
* molecular-weight:
** 71.079
+
** 985.829
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R311-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14797]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acrylamide}}
+
{{#set: common-name=(3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa}}
{{#set: inchi-key=inchikey=hrpvxlwxlxdghg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=zzvzpdqtnsjqpz-voxmgfccsa-j}}
{{#set: molecular-weight=71.079}}
+
{{#set: molecular-weight=985.829}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15686

  • common-name:
    • (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zzvzpdqtnsjqpz-voxmgfccsa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality