Difference between revisions of "CPD-15686"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7033 == * common-name: ** 2-methylbutanol * smiles: ** ccc(co)c * inchi-key: ** qprqedxdyozyla-uhfffaoysa-n * molecular-weight: ** 88...") |
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) * inchi-key: ** xzkihkmte...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-194 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenyl phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzkihkmtemtjqx-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.074 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenyl phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.074}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- molecular-weight:
- 217.074
