Difference between revisions of "CPD-15687"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05600 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACCOAth ** Category: [...") |
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite THIAMINE-P == |
− | = | + | * common-name: |
− | + | ** thiamine phosphate | |
− | == | + | * smiles: |
− | * | + | ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) |
− | ** | + | * inchi-key: |
− | ** | + | ** hzsajdvwzrbgif-uhfffaoysa-m |
− | * [[ | + | * molecular-weight: |
− | * | + | ** 343.317 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-3542]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12610]] | |
− | {{#set: | + | * [[RXN-12611]] |
− | {{#set: | + | * [[RXN0-3542]] |
+ | * [[THI-P-SYN-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=thiamine phosphate}} | ||
+ | {{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=343.317}} |
Revision as of 20:33, 18 December 2020
Contents
Metabolite THIAMINE-P
- common-name:
- thiamine phosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- hzsajdvwzrbgif-uhfffaoysa-m
- molecular-weight:
- 343.317