Difference between revisions of "CPD-15688"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14927 == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...")
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14927 ==
+
== Metabolite CPD-15688 ==
 
* common-name:
 
* common-name:
** phytenate
+
** (3z,5e)-dodeca-3,5-dienoyl-coa
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
+
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** wdwbnnbrpveeod-pfxvradusa-m
+
** arquzfjqpywssl-nbluimthsa-j
 
* molecular-weight:
 
* molecular-weight:
** 309.511
+
** 941.776
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-480]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-479]]
+
* [[RXN-14799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenate}}
+
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
+
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
{{#set: molecular-weight=309.511}}
+
{{#set: molecular-weight=941.776}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-15688

  • common-name:
    • (3z,5e)-dodeca-3,5-dienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • arquzfjqpywssl-nbluimthsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality