Difference between revisions of "CPD-15688"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-D2-ENOYL-COA == * common-name: ** a cis-2-enoyl-coa == Reaction(s) known to consume the compound == * RXN-17475 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15688 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3z,5e)-dodeca-3,5-dienoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** arquzfjqpywssl-nbluimthsa-j | ||
| + | * molecular-weight: | ||
| + | ** 941.776 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14799]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}} |
| + | {{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}} | ||
| + | {{#set: molecular-weight=941.776}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-15688
- common-name:
- (3z,5e)-dodeca-3,5-dienoyl-coa
- smiles:
- ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- arquzfjqpywssl-nbluimthsa-j
- molecular-weight:
- 941.776
