Difference between revisions of "CPD-15688"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11267 RXN-11267] == * direction: ** left-to-right * common-name: ** s-adenosyl-l-methionine:hal...")
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11267 RXN-11267] ==
+
== Metabolite CPD-641 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** s-adenosyl-l-methionine:halide/bisulfide methyltransferase
+
** (r)-mevalonate diphosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.165 ec-2.1.1.165]
+
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CL-]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-845]][c]
+
** sigqqubjqxsamw-zcfiwibfsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ09773]]
+
** 304.087
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
== Pathway(s) ==
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
* [[PWY-6730]], methylhalides biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6730 PWY-6730]
+
== Reaction(s) known to produce the compound ==
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(r)-mevalonate diphosphate}}
== External links  ==
+
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
* RHEA:
+
{{#set: molecular-weight=304.087}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27361 27361]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=s-adenosyl-l-methionine:halide/bisulfide methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.165}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-641

  • common-name:
    • (r)-mevalonate diphosphate
  • smiles:
    • cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
  • inchi-key:
    • sigqqubjqxsamw-zcfiwibfsa-j
  • molecular-weight:
    • 304.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality