Difference between revisions of "CPD-15688"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...")
(Created page with "Category:metabolite == Metabolite CPD-17368 == * common-name: ** trans-adre-2-enoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-641 ==
+
== Metabolite CPD-17368 ==
 
* common-name:
 
* common-name:
** (r)-mevalonate diphosphate
+
** trans-adre-2-enoyl-coa
 
* smiles:
 
* smiles:
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
+
** cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** sigqqubjqxsamw-zcfiwibfsa-j
+
** xsibquoflnivek-xpbiuritsa-j
 
* molecular-weight:
 
* molecular-weight:
** 304.087
+
** 1075.997
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[RXN-16113]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-mevalonate diphosphate}}
+
{{#set: common-name=trans-adre-2-enoyl-coa}}
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
+
{{#set: inchi-key=inchikey=xsibquoflnivek-xpbiuritsa-j}}
{{#set: molecular-weight=304.087}}
+
{{#set: molecular-weight=1075.997}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-17368

  • common-name:
    • trans-adre-2-enoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xsibquoflnivek-xpbiuritsa-j
  • molecular-weight:
    • 1075.997

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality