Difference between revisions of "CPD-15689"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] == * direction: ** left-to-right * common-name: ** lipid hydroperoxide peroxid...")
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] ==
+
== Metabolite CPD-15689 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lipid hydroperoxide peroxidase
+
** (2e,5e)-dodeca-2,5-dienoyl-coa
−
** peroxiredoxin
+
* smiles:
−
* ec-number:
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
** [http://enzyme.expasy.org/EC/1.11.1.15 ec-1.11.1.15]
+
* inchi-key:
−
== Reaction formula ==
+
** zsjrxhrcabosnc-uovvplbnsa-j
−
* 1 [[Alkyl-Hydro-Peroxides]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Alcohols]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 941.776
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ17464]]
+
* [[RXN-14801]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ08693]]
+
{{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=941.776}}
−
* Gene: [[SJ13686]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ03022]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ00779]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ20383]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ12662]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ22267]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ00850]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=lipid hydroperoxide peroxidase|peroxiredoxin}}
 
−
{{#set: ec-number=ec-1.11.1.15}}
 
−
{{#set: nb gene associated=9}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-15689

  • common-name:
    • (2e,5e)-dodeca-2,5-dienoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-uovvplbnsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15689&oldid=138809"