Difference between revisions of "CPD-15692"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...") |
(Created page with "Category:metabolite == Metabolite HYDROGEN-MOLECULE == * common-name: ** h2 * smiles: ** [hh] * inchi-key: ** ufhflcqgniynrp-uhfffaoysa-n * molecular-weight: ** 2.016 == R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HYDROGEN-MOLECULE == |
* common-name: | * common-name: | ||
− | ** | + | ** h2 |
* smiles: | * smiles: | ||
− | ** | + | ** [hh] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ufhflcqgniynrp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 2.016 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HYDROG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HYDROG-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=h2}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufhflcqgniynrp-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=2.016}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite HYDROGEN-MOLECULE
- common-name:
- h2
- smiles:
- [hh]
- inchi-key:
- ufhflcqgniynrp-uhfffaoysa-n
- molecular-weight:
- 2.016