Difference between revisions of "CPD-15692"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HYDROGEN-MOLECULE == * common-name: ** h2 * smiles: ** [hh] * inchi-key: ** ufhflcqgniynrp-uhfffaoysa-n * molecular-weight: ** 2.016 == R...") |
(Created page with "Category:metabolite == Metabolite CPD-8084 == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8084 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:3-2-18:2-digalactosyldiacylglycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ohmfskzmpvonkq-ierpwchasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 939.231 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8311]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8310]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=939.231}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-8084
- common-name:
- 1-18:3-2-18:2-digalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
- inchi-key:
- ohmfskzmpvonkq-ierpwchasa-n
- molecular-weight:
- 939.231
