|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ12670 == | + | == Metabolite SEROTONIN == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** serotonin |
| − | * right-end-position: | + | * smiles: |
| − | ** 89698
| + | ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 50762 | + | ** qzaygjvttncvmb-uhfffaoysa-o |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 14.256387
| + | ** 177.225 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-10777]] |
| − | == Reaction(s) associated == | + | * [[RXN-10778]] |
| − | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[RXN3DJ-170]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | * [[BIOTIN-CARBOXYL-RXN]]
| + | {{#set: common-name=serotonin}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=qzaygjvttncvmb-uhfffaoysa-o}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=177.225}} |
| − | * [[DALADALALIG-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[PCr]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[PYRUVATE-CARBOXYLASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-7388]] | |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6679]] | |
| − | ** '''1''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5744]] | |
| − | ** '''4''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-5743]]
| |
| − | ** '''5''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-5789]]
| |
| − | ** '''8''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY0-1264]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7953]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6386]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6387]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5750]]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[P42-PWY]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY66-399]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-6146]]
| |
| − | ** '''9''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6142]]
| |
| − | ** '''10''' reactions found over '''13''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=89698}} | |
| − | {{#set: left-end-position=50762}}
| |
| − | {{#set: centisome-position=14.256387 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=5}}
| |
| − | {{#set: nb pathway associated=14}}
| |
