Difference between revisions of "CPD-15699"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n)) * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-15699 == * common-name: ** aldehydo-l-arabinose * smiles: ** [ch](=o)c(o)c(o)c(o)co * inchi-key: ** pymyphuhkuwmla-vayjurfesa-n * mol...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15699 == |
* common-name: | * common-name: | ||
− | ** | + | ** aldehydo-l-arabinose |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)c(o)c(o)c(o)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pymyphuhkuwmla-vayjurfesa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14102]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-14102]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=aldehydo-l-arabinose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pymyphuhkuwmla-vayjurfesa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-15699
- common-name:
- aldehydo-l-arabinose
- smiles:
- [ch](=o)c(o)c(o)c(o)co
- inchi-key:
- pymyphuhkuwmla-vayjurfesa-n
- molecular-weight:
- 150.131