Difference between revisions of "CPD-15699"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10762 == * transcription-direction: ** negative * right-end-position: ** 152821 * left-end-position: ** 150472 * centisome-position: ** 39.11686...")
(Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n)) * inc...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10762 ==
+
== Metabolite CDP-CHOLINE ==
* transcription-direction:
+
* common-name:
** negative
+
** cdp-choline
* right-end-position:
+
* smiles:
** 152821
+
** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n))
* left-end-position:
+
* inchi-key:
** 150472
+
** rzzpdxzprhqocg-ojakkhqrsa-m
* centisome-position:
+
* molecular-weight:
** 39.11686   
+
** 487.319
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
== Reaction(s) associated ==
+
* [[RXN-17733]]
* [[1.14.11.2-RXN]]
+
* [[RXN-5781]]
** Category: [[annotation]]
+
* [[RXN-9614]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN66-578]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[2.7.7.15-RXN]]
* [[RXN490-3641]]
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
** Category: [[orthology]]
+
* [[CHLPCTDh]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-5781]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-9614]]
== Pathway(s) associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7894]]
+
{{#set: common-name=cdp-choline}}
** '''1''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=rzzpdxzprhqocg-ojakkhqrsa-m}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=487.319}}
{{#set: right-end-position=152821}}
 
{{#set: left-end-position=150472}}
 
{{#set: centisome-position=39.11686    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite CDP-CHOLINE

  • common-name:
    • cdp-choline
  • smiles:
    • c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n))
  • inchi-key:
    • rzzpdxzprhqocg-ojakkhqrsa-m
  • molecular-weight:
    • 487.319

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality